C18H20FN3O3 — CID 141444462
methyl 2-[3-amino-6-(4-hydroxycyclohexyl)pyrazin-2-yl]-6-fluorobenzoate (PubChem CID 141444462) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is methyl 2-[3-amino-6-(4-hydroxycyclohexyl)pyrazin-2-yl]-6-fluorobenzoate.
| Compound Name | methyl 2-[3-amino-6-(4-hydroxycyclohexyl)pyrazin-2-yl]-6-fluorobenzoate |
|---|---|
| PubChem CID | 141444462 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | methyl 2-[3-amino-6-(4-hydroxycyclohexyl)pyrazin-2-yl]-6-fluorobenzoate |
| SMILES | COC(=O)c1c(F)cccc1-c1nc(C2CCC(O)CC2)cnc1N |
| InChI | InChI=1S/C18H20FN3O3/c1-25-18(24)15-12(3-2-4-13(15)19)16-17(20)21-9-14(22-16)10-5-7-11(23)8-6-10/h2-4,9-11,23H,5-8H2,1H3,(H2,20,21) |
| InChIKey | PHGXWFMKCOJDBC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |