C19H22N2O3 — CID 141445865
1-spiro[chromeno[3,4-c]pyridine-5,3'-oxetane]-8-yloxypentan-2-amine (PubChem CID 141445865) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-spiro[chromeno[3,4-c]pyridine-5,3'-oxetane]-8-yloxypentan-2-amine.
| Compound Name | 1-spiro[chromeno[3,4-c]pyridine-5,3'-oxetane]-8-yloxypentan-2-amine |
|---|---|
| PubChem CID | 141445865 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1-spiro[chromeno[3,4-c]pyridine-5,3'-oxetane]-8-yloxypentan-2-amine |
| SMILES | CCCC(N)COc1ccc2c(c1)OC1(COC1)c1cnccc1-2 |
| InChI | InChI=1S/C19H22N2O3/c1-2-3-13(20)10-23-14-4-5-16-15-6-7-21-9-17(15)19(11-22-12-19)24-18(16)8-14/h4-9,13H,2-3,10-12,20H2,1H3 |
| InChIKey | FAGPVIYCPDHYAZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |