C25H25ClN6O — CID 141446251
7-chloro-N-[2-methoxy-6-(4-methylpiperazin-1-yl)-3-pyridinyl]-8-phenylquinazolin-2-amine (PubChem CID 141446251) has the molecular formula C25H25ClN6O and a molecular weight of 460.97 g/mol. Its IUPAC name is 7-chloro-N-[2-methoxy-6-(4-methylpiperazin-1-yl)-3-pyridinyl]-8-phenylquinazolin-2-amine.
| Compound Name | 7-chloro-N-[2-methoxy-6-(4-methylpiperazin-1-yl)-3-pyridinyl]-8-phenylquinazolin-2-amine |
|---|---|
| PubChem CID | 141446251 |
| Molecular Formula | C25H25ClN6O |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 7-chloro-N-[2-methoxy-6-(4-methylpiperazin-1-yl)-3-pyridinyl]-8-phenylquinazolin-2-amine |
| SMILES | COc1nc(N2CCN(C)CC2)ccc1Nc1ncc2ccc(Cl)c(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C25H25ClN6O/c1-31-12-14-32(15-13-31)21-11-10-20(24(29-21)33-2)28-25-27-16-18-8-9-19(26)22(23(18)30-25)17-6-4-3-5-7-17/h3-11,16H,12-15H2,1-2H3,(H,27,28,30) |
| InChIKey | WGWMJTPTZXXIQL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |