About 2-nitro-1,3-benzothiazin-4-one
2-nitro-1,3-benzothiazin-4-one (PubChem CID 141446794) has the molecular formula C8H4N2O3S
and a molecular weight of 208.20 g/mol. Its IUPAC name is 2-nitro-1,3-benzothiazin-4-one.
Molecular Properties
| Compound Name | 2-nitro-1,3-benzothiazin-4-one |
| PubChem CID | 141446794 |
| Molecular Formula | C8H4N2O3S |
| Molecular Weight | 208.20 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | 2-nitro-1,3-benzothiazin-4-one |
| SMILES | O=c1nc([N+](=O)[O-])sc2ccccc12 |
| InChI | InChI=1S/C8H4N2O3S/c11-7-5-3-1-2-4-6(5)14-8(9-7)10(12)13/h1-4H |
| InChIKey | DOUZRAVSBZETNL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-1,3-benzothiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-1,3-benzothiazin-4-one?
The IUPAC name of 2-nitro-1,3-benzothiazin-4-one (CID 141446794) is 2-nitro-1,3-benzothiazin-4-one.
What is the SMILES notation for 2-nitro-1,3-benzothiazin-4-one?
The canonical SMILES for 2-nitro-1,3-benzothiazin-4-one is O=c1nc([N+](=O)[O-])sc2ccccc12.
What is the InChIKey of 2-nitro-1,3-benzothiazin-4-one?
The InChIKey is DOUZRAVSBZETNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O3S/c11-7-5-3-1-2-4-6(5)14-8(9-7)10(12)13/h1-4H.
What are the key properties of 2-nitro-1,3-benzothiazin-4-one?
2-nitro-1,3-benzothiazin-4-one has a molecular weight of 208.20 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-1,3-benzothiazin-4-one is sourced from PubChem (CID 141446794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).