C20H20ClF3O5 — CID 141447255
methyl (2S,3S,4R)-4-(3-chlorophenyl)-2-hydroxy-7,7-dimethyl-5-oxo-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate (PubChem CID 141447255) has the molecular formula C20H20ClF3O5 and a molecular weight of 432.82 g/mol. Its IUPAC name is methyl (2S,3S,4R)-4-(3-chlorophenyl)-2-hydroxy-7,7-dimethyl-5-oxo-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate.
| Compound Name | methyl (2S,3S,4R)-4-(3-chlorophenyl)-2-hydroxy-7,7-dimethyl-5-oxo-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 141447255 |
| Molecular Formula | C20H20ClF3O5 |
| Molecular Weight | 432.82 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | methyl (2S,3S,4R)-4-(3-chlorophenyl)-2-hydroxy-7,7-dimethyl-5-oxo-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](c2cccc(Cl)c2)C2=C(CC(C)(C)CC2=O)O[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C20H20ClF3O5/c1-18(2)8-12(25)15-13(9-18)29-19(27,20(22,23)24)16(17(26)28-3)14(15)10-5-4-6-11(21)7-10/h4-7,14,16,27H,8-9H2,1-3H3/t14-,16-,19+/m1/s1 |
| InChIKey | DSUBATJAYXXVPU-OGWOLHLISA-N |
| XLogP | 4.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.82 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |