C15H11BrN2O7 — CID 141447544
2-bromo-3-(3,5-dimethylphenoxy)-4,6-dinitrobenzoic acid (PubChem CID 141447544) has the molecular formula C15H11BrN2O7 and a molecular weight of 411.16 g/mol. Its IUPAC name is 2-bromo-3-(3,5-dimethylphenoxy)-4,6-dinitrobenzoic acid.
| Compound Name | 2-bromo-3-(3,5-dimethylphenoxy)-4,6-dinitrobenzoic acid |
|---|---|
| PubChem CID | 141447544 |
| Molecular Formula | C15H11BrN2O7 |
| Molecular Weight | 411.16 g/mol |
| Exact Mass | 409.97 |
| IUPAC Name | 2-bromo-3-(3,5-dimethylphenoxy)-4,6-dinitrobenzoic acid |
| SMILES | Cc1cc(C)cc(Oc2c([N+](=O)[O-])cc([N+](=O)[O-])c(C(=O)O)c2Br)c1 |
| InChI | InChI=1S/C15H11BrN2O7/c1-7-3-8(2)5-9(4-7)25-14-11(18(23)24)6-10(17(21)22)12(13(14)16)15(19)20/h3-6H,1-2H3,(H,19,20) |
| InChIKey | PJSMVHHHJDRZRS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.16 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|