C22H20O5 — CID 141454006
(1E,6E)-1-(4-hydroxyphenyl)-7-(4-hydroxy-3-prop-2-enoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 141454006) has the molecular formula C22H20O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is (1E,6E)-1-(4-hydroxyphenyl)-7-(4-hydroxy-3-prop-2-enoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-(4-hydroxyphenyl)-7-(4-hydroxy-3-prop-2-enoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 141454006 |
| Molecular Formula | C22H20O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (1E,6E)-1-(4-hydroxyphenyl)-7-(4-hydroxy-3-prop-2-enoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | C=CCOc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C22H20O5/c1-2-13-27-22-14-17(7-12-21(22)26)6-11-20(25)15-19(24)10-5-16-3-8-18(23)9-4-16/h2-12,14,23,26H,1,13,15H2/b10-5+,11-6+ |
| InChIKey | HKNXSRQASNEAQC-YOYBCKCWSA-N |
| XLogP | 3.92 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|