C12H12ClN3 — CID 141454336
1-azido-4-chloro-2-(3,3-dimethylbut-1-ynyl)benzene (PubChem CID 141454336) has the molecular formula C12H12ClN3 and a molecular weight of 233.70 g/mol. Its IUPAC name is 1-azido-4-chloro-2-(3,3-dimethylbut-1-ynyl)benzene.
| Compound Name | 1-azido-4-chloro-2-(3,3-dimethylbut-1-ynyl)benzene |
|---|---|
| PubChem CID | 141454336 |
| Molecular Formula | C12H12ClN3 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 1-azido-4-chloro-2-(3,3-dimethylbut-1-ynyl)benzene |
| SMILES | CC(C)(C)C#Cc1cc(Cl)ccc1N=[N+]=[N-] |
| InChI | InChI=1S/C12H12ClN3/c1-12(2,3)7-6-9-8-10(13)4-5-11(9)15-16-14/h4-5,8H,1-3H3 |
| InChIKey | RIMJRJLRFDSMRR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|