C10H10ClN3S2 — CID 53354897
2-(2-azido-5-chlorophenyl)-1,3-dithiane (PubChem CID 53354897) has the molecular formula C10H10ClN3S2 and a molecular weight of 271.80 g/mol. Its IUPAC name is 2-(2-azido-5-chlorophenyl)-1,3-dithiane.
| Compound Name | 2-(2-azido-5-chlorophenyl)-1,3-dithiane |
|---|---|
| PubChem CID | 53354897 |
| Molecular Formula | C10H10ClN3S2 |
| Molecular Weight | 271.80 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 2-(2-azido-5-chlorophenyl)-1,3-dithiane |
| SMILES | [N-]=[N+]=Nc1ccc(Cl)cc1C1SCCCS1 |
| InChI | InChI=1S/C10H10ClN3S2/c11-7-2-3-9(13-14-12)8(6-7)10-15-4-1-5-16-10/h2-3,6,10H,1,4-5H2 |
| InChIKey | UGGRQYXFQAIHTO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.80 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|