C10H9ClFNO2S2 — CID 54080557
2-(2-chloro-4-fluoro-3-nitrophenyl)-1,3-dithiane (PubChem CID 54080557) has the molecular formula C10H9ClFNO2S2 and a molecular weight of 293.77 g/mol. Its IUPAC name is 2-(2-chloro-4-fluoro-3-nitrophenyl)-1,3-dithiane.
| Compound Name | 2-(2-chloro-4-fluoro-3-nitrophenyl)-1,3-dithiane |
|---|---|
| PubChem CID | 54080557 |
| Molecular Formula | C10H9ClFNO2S2 |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 2-(2-chloro-4-fluoro-3-nitrophenyl)-1,3-dithiane |
| SMILES | O=[N+]([O-])c1c(F)ccc(C2SCCCS2)c1Cl |
| InChI | InChI=1S/C10H9ClFNO2S2/c11-8-6(10-16-4-1-5-17-10)2-3-7(12)9(8)13(14)15/h2-3,10H,1,4-5H2 |
| InChIKey | MMUJWHXMKLDCCA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|