C10H17NO3S2 — CID 141459284
tert-butyl 2-(4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl)propanoate (PubChem CID 141459284) has the molecular formula C10H17NO3S2 and a molecular weight of 263.38 g/mol. Its IUPAC name is tert-butyl 2-(4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl)propanoate.
| Compound Name | tert-butyl 2-(4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl)propanoate |
|---|---|
| PubChem CID | 141459284 |
| Molecular Formula | C10H17NO3S2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | tert-butyl 2-(4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl)propanoate |
| SMILES | CC(C(=O)OC(C)(C)C)N1C(=O)CSC1S |
| InChI | InChI=1S/C10H17NO3S2/c1-6(8(13)14-10(2,3)4)11-7(12)5-16-9(11)15/h6,9,15H,5H2,1-4H3 |
| InChIKey | AGRBWCHEUICWCS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|