C19H27N3O3S2 — CID 178035800
tert-butyl 4-[4-[(4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl)methyl]phenyl]piperazine-1-carboxylate (PubChem CID 178035800) has the molecular formula C19H27N3O3S2 and a molecular weight of 409.58 g/mol. Its IUPAC name is tert-butyl 4-[4-[(4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl)methyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl)methyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 178035800 |
| Molecular Formula | C19H27N3O3S2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | tert-butyl 4-[4-[(4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl)methyl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(CN3C(=O)CSC3S)cc2)CC1 |
| InChI | InChI=1S/C19H27N3O3S2/c1-19(2,3)25-17(24)21-10-8-20(9-11-21)15-6-4-14(5-7-15)12-22-16(23)13-27-18(22)26/h4-7,18,26H,8-13H2,1-3H3 |
| InChIKey | ACXLPDZGEQFODP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|