C27H40O6 — CID 141459698
(2S,3R,4R,5R)-4,6-bis[(3,4-dimethylphenyl)methyl]nonane-1,2,3,4,5,6-hexol (PubChem CID 141459698) has the molecular formula C27H40O6 and a molecular weight of 460.61 g/mol. Its IUPAC name is (2S,3R,4R,5R)-4,6-bis[(3,4-dimethylphenyl)methyl]nonane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-4,6-bis[(3,4-dimethylphenyl)methyl]nonane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459698 |
| Molecular Formula | C27H40O6 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | (2S,3R,4R,5R)-4,6-bis[(3,4-dimethylphenyl)methyl]nonane-1,2,3,4,5,6-hexol |
| SMILES | CCCC(O)(Cc1ccc(C)c(C)c1)[C@@H](O)[C@@](O)(Cc1ccc(C)c(C)c1)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C27H40O6/c1-6-11-26(32,14-21-9-7-17(2)19(4)12-21)25(31)27(33,24(30)23(29)16-28)15-22-10-8-18(3)20(5)13-22/h7-10,12-13,23-25,28-33H,6,11,14-16H2,1-5H3/t23-,24+,25+,26?,27+/m0/s1 |
| InChIKey | HWTXGSNOLJRWLS-XZDDKTJVSA-N |
| XLogP | 2.04 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |