C29H44O12 — CID 141460127
(2S,3R,4R,5R)-4,6-bis[(2,4,6-trimethoxyphenyl)methyl]nonane-1,2,3,4,5,6-hexol (PubChem CID 141460127) has the molecular formula C29H44O12 and a molecular weight of 584.66 g/mol. Its IUPAC name is (2S,3R,4R,5R)-4,6-bis[(2,4,6-trimethoxyphenyl)methyl]nonane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-4,6-bis[(2,4,6-trimethoxyphenyl)methyl]nonane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141460127 |
| Molecular Formula | C29H44O12 |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | (2S,3R,4R,5R)-4,6-bis[(2,4,6-trimethoxyphenyl)methyl]nonane-1,2,3,4,5,6-hexol |
| SMILES | CCCC(O)(Cc1c(OC)cc(OC)cc1OC)[C@@H](O)[C@@](O)(Cc1c(OC)cc(OC)cc1OC)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C29H44O12/c1-8-9-28(34,14-19-22(38-4)10-17(36-2)11-23(19)39-5)27(33)29(35,26(32)21(31)16-30)15-20-24(40-6)12-18(37-3)13-25(20)41-7/h10-13,21,26-27,30-35H,8-9,14-16H2,1-7H3/t21-,26+,27+,28?,29+/m0/s1 |
| InChIKey | QVZHYZHDLYQORT-LPZRXZDJSA-N |
| XLogP | 0.86 |
| TPSA | 176.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |