C28H42O6 — CID 141460140
(2S,3R,4R,5R)-4,6-bis[(3-propan-2-ylphenyl)methyl]octane-1,2,3,4,5,6-hexol (PubChem CID 141460140) has the molecular formula C28H42O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is (2S,3R,4R,5R)-4,6-bis[(3-propan-2-ylphenyl)methyl]octane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-4,6-bis[(3-propan-2-ylphenyl)methyl]octane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141460140 |
| Molecular Formula | C28H42O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | (2S,3R,4R,5R)-4,6-bis[(3-propan-2-ylphenyl)methyl]octane-1,2,3,4,5,6-hexol |
| SMILES | CCC(O)(Cc1cccc(C(C)C)c1)[C@@H](O)[C@@](O)(Cc1cccc(C(C)C)c1)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C28H42O6/c1-6-27(33,15-20-9-7-11-22(13-20)18(2)3)26(32)28(34,25(31)24(30)17-29)16-21-10-8-12-23(14-21)19(4)5/h7-14,18-19,24-26,29-34H,6,15-17H2,1-5H3/t24-,25+,26+,27?,28+/m0/s1 |
| InChIKey | ZROJVROROCIQRG-XKXYPLPJSA-N |
| XLogP | 2.67 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |