C26H30F6O6 — CID 141459658
(2S,3R,4R,5R)-8-methyl-4,6-bis[[3-(trifluoromethyl)phenyl]methyl]non-8-ene-1,2,3,4,5,6-hexol (PubChem CID 141459658) has the molecular formula C26H30F6O6 and a molecular weight of 552.51 g/mol. Its IUPAC name is (2S,3R,4R,5R)-8-methyl-4,6-bis[[3-(trifluoromethyl)phenyl]methyl]non-8-ene-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-8-methyl-4,6-bis[[3-(trifluoromethyl)phenyl]methyl]non-8-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459658 |
| Molecular Formula | C26H30F6O6 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | (2S,3R,4R,5R)-8-methyl-4,6-bis[[3-(trifluoromethyl)phenyl]methyl]non-8-ene-1,2,3,4,5,6-hexol |
| SMILES | C=C(C)CC(O)(Cc1cccc(C(F)(F)F)c1)[C@@H](O)[C@@](O)(Cc1cccc(C(F)(F)F)c1)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C26H30F6O6/c1-15(2)11-23(37,12-16-5-3-7-18(9-16)25(27,28)29)22(36)24(38,21(35)20(34)14-33)13-17-6-4-8-19(10-17)26(30,31)32/h3-10,20-22,33-38H,1,11-14H2,2H3/t20-,21+,22+,23?,24+/m0/s1 |
| InChIKey | STCYSWYXURWEFB-XAWFNSNLSA-N |
| XLogP | 3.01 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|