C32H48O6 — CID 141459858
(2S,3R,4R,5R)-4,6-bis[(3-tert-butylphenyl)methyl]-8-methylnon-8-ene-1,2,3,4,5,6-hexol (PubChem CID 141459858) has the molecular formula C32H48O6 and a molecular weight of 528.73 g/mol. Its IUPAC name is (2S,3R,4R,5R)-4,6-bis[(3-tert-butylphenyl)methyl]-8-methylnon-8-ene-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-4,6-bis[(3-tert-butylphenyl)methyl]-8-methylnon-8-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459858 |
| Molecular Formula | C32H48O6 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | (2S,3R,4R,5R)-4,6-bis[(3-tert-butylphenyl)methyl]-8-methylnon-8-ene-1,2,3,4,5,6-hexol |
| SMILES | C=C(C)CC(O)(Cc1cccc(C(C)(C)C)c1)[C@@H](O)[C@@](O)(Cc1cccc(C(C)(C)C)c1)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C32H48O6/c1-21(2)17-31(37,18-22-11-9-13-24(15-22)29(3,4)5)28(36)32(38,27(35)26(34)20-33)19-23-12-10-14-25(16-23)30(6,7)8/h9-16,26-28,33-38H,1,17-20H2,2-8H3/t26-,27+,28+,31?,32+/m0/s1 |
| InChIKey | YLHBLACPOJGBGE-KNFJTVGASA-N |
| XLogP | 3.57 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|