C32H48O6 — CID 141459532
(E,2S,3R,4R,5R)-4,6-bis[(3-butylphenyl)methyl]dec-8-ene-1,2,3,4,5,6-hexol (PubChem CID 141459532) has the molecular formula C32H48O6 and a molecular weight of 528.73 g/mol. Its IUPAC name is (E,2S,3R,4R,5R)-4,6-bis[(3-butylphenyl)methyl]dec-8-ene-1,2,3,4,5,6-hexol.
| Compound Name | (E,2S,3R,4R,5R)-4,6-bis[(3-butylphenyl)methyl]dec-8-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459532 |
| Molecular Formula | C32H48O6 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | (E,2S,3R,4R,5R)-4,6-bis[(3-butylphenyl)methyl]dec-8-ene-1,2,3,4,5,6-hexol |
| SMILES | C/C=C/CC(O)(Cc1cccc(CCCC)c1)[C@@H](O)[C@@](O)(Cc1cccc(CCCC)c1)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C32H48O6/c1-4-7-12-24-14-10-16-26(19-24)21-31(37,18-9-6-3)30(36)32(38,29(35)28(34)23-33)22-27-17-11-15-25(20-27)13-8-5-2/h6,9-11,14-17,19-20,28-30,33-38H,4-5,7-8,12-13,18,21-23H2,1-3H3/b9-6+/t28-,29+,30+,31?,32+/m0/s1 |
| InChIKey | DUZUZJWDLLJYNO-MDHIMBMQSA-N |
| XLogP | 3.66 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|