C26H38O6 — CID 141459837
(2S,3R,4R,5R)-4,6-bis[(2-ethylphenyl)methyl]octane-1,2,3,4,5,6-hexol (PubChem CID 141459837) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is (2S,3R,4R,5R)-4,6-bis[(2-ethylphenyl)methyl]octane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-4,6-bis[(2-ethylphenyl)methyl]octane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459837 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (2S,3R,4R,5R)-4,6-bis[(2-ethylphenyl)methyl]octane-1,2,3,4,5,6-hexol |
| SMILES | CCc1ccccc1CC(O)(CC)[C@@H](O)[C@@](O)(Cc1ccccc1CC)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C26H38O6/c1-4-18-11-7-9-13-20(18)15-25(31,6-3)24(30)26(32,23(29)22(28)17-27)16-21-14-10-8-12-19(21)5-2/h7-14,22-24,27-32H,4-6,15-17H2,1-3H3/t22-,23+,24+,25?,26+/m0/s1 |
| InChIKey | AUUVYXBRFOCKSN-KALDWRKLSA-N |
| XLogP | 1.54 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |