C21H12F5IN2O2 — CID 141462175
(Z)-1-[3-(3,4-difluorophenyl)-4-iodo-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]pent-2-ene-1,4-dione (PubChem CID 141462175) has the molecular formula C21H12F5IN2O2 and a molecular weight of 546.23 g/mol. Its IUPAC name is (Z)-1-[3-(3,4-difluorophenyl)-4-iodo-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]pent-2-ene-1,4-dione.
| Compound Name | (Z)-1-[3-(3,4-difluorophenyl)-4-iodo-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]pent-2-ene-1,4-dione |
|---|---|
| PubChem CID | 141462175 |
| Molecular Formula | C21H12F5IN2O2 |
| Molecular Weight | 546.23 g/mol |
| Exact Mass | 545.99 |
| IUPAC Name | (Z)-1-[3-(3,4-difluorophenyl)-4-iodo-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]pent-2-ene-1,4-dione |
| SMILES | CC(=O)/C=C\C(=O)c1c(I)c(-c2ccc(F)c(F)c2)nn1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H12F5IN2O2/c1-11(30)2-9-17(31)20-18(27)19(12-3-8-15(22)16(23)10-12)28-29(20)14-6-4-13(5-7-14)21(24,25)26/h2-10H,1H3/b9-2- |
| InChIKey | GTXSOQDWGNCTGY-MBXJOHMKSA-N |
| XLogP | 5.77 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.23 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|