C19H12F3N3O3 — CID 141462160
(E)-4-oxo-4-[3-pyridin-4-yl-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]but-2-enoic acid (PubChem CID 141462160) has the molecular formula C19H12F3N3O3 and a molecular weight of 387.32 g/mol. Its IUPAC name is (E)-4-oxo-4-[3-pyridin-4-yl-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[3-pyridin-4-yl-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 141462160 |
| Molecular Formula | C19H12F3N3O3 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | (E)-4-oxo-4-[3-pyridin-4-yl-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]but-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)c1cc(-c2ccncc2)nn1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H12F3N3O3/c20-19(21,22)13-1-3-14(4-2-13)25-16(17(26)5-6-18(27)28)11-15(24-25)12-7-9-23-10-8-12/h1-11H,(H,27,28)/b6-5+ |
| InChIKey | MCHXRPZAGBIWOS-AATRIKPKSA-N |
| XLogP | 3.78 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|