C20H14F3N3O2 — CID 141462147
(E)-1-[3-pyridin-4-yl-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]pent-2-ene-1,4-dione (PubChem CID 141462147) has the molecular formula C20H14F3N3O2 and a molecular weight of 385.35 g/mol. Its IUPAC name is (E)-1-[3-pyridin-4-yl-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]pent-2-ene-1,4-dione.
| Compound Name | (E)-1-[3-pyridin-4-yl-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]pent-2-ene-1,4-dione |
|---|---|
| PubChem CID | 141462147 |
| Molecular Formula | C20H14F3N3O2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (E)-1-[3-pyridin-4-yl-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]pent-2-ene-1,4-dione |
| SMILES | CC(=O)/C=C/C(=O)c1cc(-c2ccncc2)nn1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H14F3N3O2/c1-13(27)2-7-19(28)18-12-17(14-8-10-24-11-9-14)25-26(18)16-5-3-15(4-6-16)20(21,22)23/h2-12H,1H3/b7-2+ |
| InChIKey | YUUIBUFMUZOASX-FARCUNLSSA-N |
| XLogP | 4.28 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|