About acetic acid;4-(trifluoromethyl)pyridine;hydrobromide
acetic acid;4-(trifluoromethyl)pyridine;hydrobromide (PubChem CID 174739301) has the molecular formula C8H9BrF3NO2
and a molecular weight of 288.06 g/mol. Its IUPAC name is acetic acid;4-(trifluoromethyl)pyridine;hydrobromide.
Molecular Properties
| Compound Name | acetic acid;4-(trifluoromethyl)pyridine;hydrobromide |
| PubChem CID | 174739301 |
| Molecular Formula | C8H9BrF3NO2 |
| Molecular Weight | 288.06 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | acetic acid;4-(trifluoromethyl)pyridine;hydrobromide |
| SMILES | Br.CC(=O)O.FC(F)(F)c1ccncc1 |
| InChI | InChI=1S/C6H4F3N.C2H4O2.BrH/c7-6(8,9)5-1-3-10-4-2-5;1-2(3)4;/h1-4H;1H3,(H,3,4);1H |
| InChIKey | BDXNSNIBDBLXLC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.06 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetic acid;4-(trifluoromethyl)pyridine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;4-(trifluoromethyl)pyridine;hydrobromide?
The IUPAC name of acetic acid;4-(trifluoromethyl)pyridine;hydrobromide (CID 174739301) is acetic acid;4-(trifluoromethyl)pyridine;hydrobromide.
What is the SMILES notation for acetic acid;4-(trifluoromethyl)pyridine;hydrobromide?
The canonical SMILES for acetic acid;4-(trifluoromethyl)pyridine;hydrobromide is Br.CC(=O)O.FC(F)(F)c1ccncc1.
What is the InChIKey of acetic acid;4-(trifluoromethyl)pyridine;hydrobromide?
The InChIKey is BDXNSNIBDBLXLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3N.C2H4O2.BrH/c7-6(8,9)5-1-3-10-4-2-5;1-2(3)4;/h1-4H;1H3,(H,3,4);1H.
What are the key properties of acetic acid;4-(trifluoromethyl)pyridine;hydrobromide?
acetic acid;4-(trifluoromethyl)pyridine;hydrobromide has a molecular weight of 288.06 g/mol, XLogP of 2.77, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;4-(trifluoromethyl)pyridine;hydrobromide is sourced from PubChem (CID 174739301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).