C12H12F3NO2 — CID 69050994
4-amino-4-[4-(trifluoromethyl)phenyl]pentane-2,3-dione (PubChem CID 69050994) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is 4-amino-4-[4-(trifluoromethyl)phenyl]pentane-2,3-dione.
| Compound Name | 4-amino-4-[4-(trifluoromethyl)phenyl]pentane-2,3-dione |
|---|---|
| PubChem CID | 69050994 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-amino-4-[4-(trifluoromethyl)phenyl]pentane-2,3-dione |
| SMILES | CC(=O)C(=O)C(C)(N)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H12F3NO2/c1-7(17)10(18)11(2,16)8-3-5-9(6-4-8)12(13,14)15/h3-6H,16H2,1-2H3 |
| InChIKey | VCVSAXGVCFKTKJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|