C8H8F6OS2 — CID 141463721
2,6-bis(trifluoromethylsulfanyl)cyclohexan-1-one (PubChem CID 141463721) has the molecular formula C8H8F6OS2 and a molecular weight of 298.27 g/mol. Its IUPAC name is 2,6-bis(trifluoromethylsulfanyl)cyclohexan-1-one.
| Compound Name | 2,6-bis(trifluoromethylsulfanyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 141463721 |
| Molecular Formula | C8H8F6OS2 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 2,6-bis(trifluoromethylsulfanyl)cyclohexan-1-one |
| SMILES | O=C1C(SC(F)(F)F)CCCC1SC(F)(F)F |
| InChI | InChI=1S/C8H8F6OS2/c9-7(10,11)16-4-2-1-3-5(6(4)15)17-8(12,13)14/h4-5H,1-3H2 |
| InChIKey | XGSCQGQWXPJCSS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |