C6H8BrFO — CID 23235246
trans-(2S,6S)-2-bromo-6-fluorocyclohexan-1-one (PubChem CID 23235246) has the molecular formula C6H8BrFO and a molecular weight of 195.03 g/mol. Its IUPAC name is trans-(2S,6S)-2-bromo-6-fluorocyclohexan-1-one.
| Compound Name | trans-(2S,6S)-2-bromo-6-fluorocyclohexan-1-one |
|---|---|
| PubChem CID | 23235246 |
| Molecular Formula | C6H8BrFO |
| Molecular Weight | 195.03 g/mol |
| Exact Mass | 193.97 |
| IUPAC Name | trans-(2S,6S)-2-bromo-6-fluorocyclohexan-1-one |
| SMILES | O=C1[C@@H](F)CCC[C@@H]1Br |
| InChI | InChI=1S/C6H8BrFO/c7-4-2-1-3-5(8)6(4)9/h4-5H,1-3H2/t4-,5-/m0/s1 |
| InChIKey | LGEOUIWLVMKZLU-WHFBIAKZSA-N |
| XLogP | 1.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.03 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|