C7H9BrO3 — CID 129384541
cis-(1S,3R)-3-bromo-2-oxocyclohexane-1-carboxylic acid (PubChem CID 129384541) has the molecular formula C7H9BrO3 and a molecular weight of 221.05 g/mol. Its IUPAC name is cis-(1S,3R)-3-bromo-2-oxocyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,3R)-3-bromo-2-oxocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 129384541 |
| Molecular Formula | C7H9BrO3 |
| Molecular Weight | 221.05 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | cis-(1S,3R)-3-bromo-2-oxocyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCC[C@@H](Br)C1=O |
| InChI | InChI=1S/C7H9BrO3/c8-5-3-1-2-4(6(5)9)7(10)11/h4-5H,1-3H2,(H,10,11)/t4-,5+/m0/s1 |
| InChIKey | AUQWJFMEDWJXNT-CRCLSJGQSA-N |
| XLogP | 1.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.05 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|