3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid

C7H6Br2O4 — CID 57066920

IUPAC3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid
SMILESO=C1C(Br)CC(C(=O)O)C(=O)C1Br
InChIInChI=1S/C7H6Br2O4/c8-3-1-2(7(12)13)5(10)4(9)6(3)11/h2-4H,1H2,(H,12,13)
InChIKeyDEMRDOADJHMAJO-UHFFFAOYSA-N
MW313.93 g/mol
LogP0.76
Rot. Bonds1

About 3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid

3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid (PubChem CID 57066920) has the molecular formula C7H6Br2O4 and a molecular weight of 313.93 g/mol. Its IUPAC name is 3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid
PubChem CID57066920
Molecular FormulaC7H6Br2O4
Molecular Weight313.93 g/mol
Exact Mass311.86
IUPAC Name3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid
SMILESO=C1C(Br)CC(C(=O)O)C(=O)C1Br
InChIInChI=1S/C7H6Br2O4/c8-3-1-2(7(12)13)5(10)4(9)6(3)11/h2-4H,1H2,(H,12,13)
InChIKeyDEMRDOADJHMAJO-UHFFFAOYSA-N
XLogP0.76
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.93
LogP ≤ 50.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid?
The IUPAC name of 3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid (CID 57066920) is 3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid.
What is the SMILES notation for 3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid?
The canonical SMILES for 3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid is O=C1C(Br)CC(C(=O)O)C(=O)C1Br.
What is the InChIKey of 3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid?
The InChIKey is DEMRDOADJHMAJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Br2O4/c8-3-1-2(7(12)13)5(10)4(9)6(3)11/h2-4H,1H2,(H,12,13).
What are the key properties of 3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid?
3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid has a molecular weight of 313.93 g/mol, XLogP of 0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid is sourced from PubChem (CID 57066920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).