C7H6Br2O4 — CID 57066920
3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid (PubChem CID 57066920) has the molecular formula C7H6Br2O4 and a molecular weight of 313.93 g/mol. Its IUPAC name is 3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid.
| Compound Name | 3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 57066920 |
| Molecular Formula | C7H6Br2O4 |
| Molecular Weight | 313.93 g/mol |
| Exact Mass | 311.86 |
| IUPAC Name | 3,5-dibromo-2,4-dioxocyclohexane-1-carboxylic acid |
| SMILES | O=C1C(Br)CC(C(=O)O)C(=O)C1Br |
| InChI | InChI=1S/C7H6Br2O4/c8-3-1-2(7(12)13)5(10)4(9)6(3)11/h2-4H,1H2,(H,12,13) |
| InChIKey | DEMRDOADJHMAJO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.93 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|