C7H10BrNO2 — CID 7335685
cis-(1R,3S)-3-bromo-2-oxocyclohexane-1-carboxamide (PubChem CID 7335685) has the molecular formula C7H10BrNO2 and a molecular weight of 220.07 g/mol. Its IUPAC name is cis-(1R,3S)-3-bromo-2-oxocyclohexane-1-carboxamide.
| Compound Name | cis-(1R,3S)-3-bromo-2-oxocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 7335685 |
| Molecular Formula | C7H10BrNO2 |
| Molecular Weight | 220.07 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | cis-(1R,3S)-3-bromo-2-oxocyclohexane-1-carboxamide |
| SMILES | NC(=O)[C@@H]1CCC[C@H](Br)C1=O |
| InChI | InChI=1S/C7H10BrNO2/c8-5-3-1-2-4(6(5)10)7(9)11/h4-5H,1-3H2,(H2,9,11)/t4-,5+/m1/s1 |
| InChIKey | TXFDMCPBDPAULJ-UHNVWZDZSA-N |
| XLogP | 0.60 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.07 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|