C7H10ClF3S — CID 11687189
trans-(1R,2R)-1-chloro-2-(trifluoromethylsulfanyl)cyclohexane (PubChem CID 11687189) has the molecular formula C7H10ClF3S and a molecular weight of 218.67 g/mol. Its IUPAC name is trans-(1R,2R)-1-chloro-2-(trifluoromethylsulfanyl)cyclohexane.
| Compound Name | trans-(1R,2R)-1-chloro-2-(trifluoromethylsulfanyl)cyclohexane |
|---|---|
| PubChem CID | 11687189 |
| Molecular Formula | C7H10ClF3S |
| Molecular Weight | 218.67 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | trans-(1R,2R)-1-chloro-2-(trifluoromethylsulfanyl)cyclohexane |
| SMILES | FC(F)(F)S[C@@H]1CCCC[C@H]1Cl |
| InChI | InChI=1S/C7H10ClF3S/c8-5-3-1-2-4-6(5)12-7(9,10)11/h5-6H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | ATTXNIPRGBFANT-PHDIDXHHSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.67 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|