About 1-chloro-2-(cyclohexylmethyldisulfanyl)cyclohexane;trifluoromethanesulfonic acid
1-chloro-2-(cyclohexylmethyldisulfanyl)cyclohexane;trifluoromethanesulfonic acid (PubChem CID 175770726) has the molecular formula C14H24ClF3O3S3
and a molecular weight of 428.99 g/mol. Its IUPAC name is 1-chloro-2-(cyclohexylmethyldisulfanyl)cyclohexane;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 1-chloro-2-(cyclohexylmethyldisulfanyl)cyclohexane;trifluoromethanesulfonic acid |
| PubChem CID | 175770726 |
| Molecular Formula | C14H24ClF3O3S3 |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 1-chloro-2-(cyclohexylmethyldisulfanyl)cyclohexane;trifluoromethanesulfonic acid |
| SMILES | ClC1CCCCC1SSCC1CCCCC1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C13H23ClS2.CHF3O3S/c14-12-8-4-5-9-13(12)16-15-10-11-6-2-1-3-7-11;2-1(3,4)8(5,6)7/h11-13H,1-10H2;(H,5,6,7) |
| InChIKey | XLSKTGLXIPNSQM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-(cyclohexylmethyldisulfanyl)cyclohexane;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-(cyclohexylmethyldisulfanyl)cyclohexane;trifluoromethanesulfonic acid?
The IUPAC name of 1-chloro-2-(cyclohexylmethyldisulfanyl)cyclohexane;trifluoromethanesulfonic acid (CID 175770726) is 1-chloro-2-(cyclohexylmethyldisulfanyl)cyclohexane;trifluoromethanesulfonic acid.
What is the SMILES notation for 1-chloro-2-(cyclohexylmethyldisulfanyl)cyclohexane;trifluoromethanesulfonic acid?
The canonical SMILES for 1-chloro-2-(cyclohexylmethyldisulfanyl)cyclohexane;trifluoromethanesulfonic acid is ClC1CCCCC1SSCC1CCCCC1.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of 1-chloro-2-(cyclohexylmethyldisulfanyl)cyclohexane;trifluoromethanesulfonic acid?
The InChIKey is XLSKTGLXIPNSQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23ClS2.CHF3O3S/c14-12-8-4-5-9-13(12)16-15-10-11-6-2-1-3-7-11;2-1(3,4)8(5,6)7/h11-13H,1-10H2;(H,5,6,7).
What are the key properties of 1-chloro-2-(cyclohexylmethyldisulfanyl)cyclohexane;trifluoromethanesulfonic acid?
1-chloro-2-(cyclohexylmethyldisulfanyl)cyclohexane;trifluoromethanesulfonic acid has a molecular weight of 428.99 g/mol, XLogP of 5.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-(cyclohexylmethyldisulfanyl)cyclohexane;trifluoromethanesulfonic acid is sourced from PubChem (CID 175770726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).