C25H25ClS2 — CID 15212582
[[[(1R,2R)-2-chlorocyclohexyl]disulfanyl]-diphenylmethyl]benzene (PubChem CID 15212582) has the molecular formula C25H25ClS2 and a molecular weight of 425.06 g/mol. Its IUPAC name is [[[(1R,2R)-2-chlorocyclohexyl]disulfanyl]-diphenylmethyl]benzene.
| Compound Name | [[[(1R,2R)-2-chlorocyclohexyl]disulfanyl]-diphenylmethyl]benzene |
|---|---|
| PubChem CID | 15212582 |
| Molecular Formula | C25H25ClS2 |
| Molecular Weight | 425.06 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | [[[(1R,2R)-2-chlorocyclohexyl]disulfanyl]-diphenylmethyl]benzene |
| SMILES | Cl[C@@H]1CCCC[C@H]1SSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25ClS2/c26-23-18-10-11-19-24(23)27-28-25(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-9,12-17,23-24H,10-11,18-19H2/t23-,24-/m1/s1 |
| InChIKey | ZUYGVPDEHWULMN-DNQXCXABSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.06 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|