C24H23ClS2 — CID 15212581
[[[(1R,2R)-2-chlorocyclopentyl]disulfanyl]-diphenylmethyl]benzene (PubChem CID 15212581) has the molecular formula C24H23ClS2 and a molecular weight of 411.04 g/mol. Its IUPAC name is [[[(1R,2R)-2-chlorocyclopentyl]disulfanyl]-diphenylmethyl]benzene.
| Compound Name | [[[(1R,2R)-2-chlorocyclopentyl]disulfanyl]-diphenylmethyl]benzene |
|---|---|
| PubChem CID | 15212581 |
| Molecular Formula | C24H23ClS2 |
| Molecular Weight | 411.04 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | [[[(1R,2R)-2-chlorocyclopentyl]disulfanyl]-diphenylmethyl]benzene |
| SMILES | Cl[C@@H]1CCC[C@H]1SSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23ClS2/c25-22-17-10-18-23(22)26-27-24(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21/h1-9,11-16,22-23H,10,17-18H2/t22-,23-/m1/s1 |
| InChIKey | FPAXQDFKFCUEAB-DHIUTWEWSA-N |
| XLogP | 7.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.04 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|