C15H12O4 — CID 141465126
9-methyl-3-propanoylfuro[2,3-h]chromen-2-one (PubChem CID 141465126) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 9-methyl-3-propanoylfuro[2,3-h]chromen-2-one.
| Compound Name | 9-methyl-3-propanoylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 141465126 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 9-methyl-3-propanoylfuro[2,3-h]chromen-2-one |
| SMILES | CCC(=O)c1cc2ccc3occ(C)c3c2oc1=O |
| InChI | InChI=1S/C15H12O4/c1-3-11(16)10-6-9-4-5-12-13(8(2)7-18-12)14(9)19-15(10)17/h4-7H,3H2,1-2H3 |
| InChIKey | WXWYKCMVAZHROV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|