C19H12O4 — CID 141465130
3-benzoyl-9-methylfuro[2,3-h]chromen-2-one (PubChem CID 141465130) has the molecular formula C19H12O4 and a molecular weight of 304.30 g/mol. Its IUPAC name is 3-benzoyl-9-methylfuro[2,3-h]chromen-2-one.
| Compound Name | 3-benzoyl-9-methylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 141465130 |
| Molecular Formula | C19H12O4 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3-benzoyl-9-methylfuro[2,3-h]chromen-2-one |
| SMILES | Cc1coc2ccc3cc(C(=O)c4ccccc4)c(=O)oc3c12 |
| InChI | InChI=1S/C19H12O4/c1-11-10-22-15-8-7-13-9-14(19(21)23-18(13)16(11)15)17(20)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | CCPGUJHNJOHQNF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|