C17H16N2O6 — CID 141465479
3-[5-oxido-4-(3,4,5-trimethoxyphenyl)-1,2,5-oxadiazol-5-ium-3-yl]phenol (PubChem CID 141465479) has the molecular formula C17H16N2O6 and a molecular weight of 344.32 g/mol. Its IUPAC name is 3-[5-oxido-4-(3,4,5-trimethoxyphenyl)-1,2,5-oxadiazol-5-ium-3-yl]phenol.
| Compound Name | 3-[5-oxido-4-(3,4,5-trimethoxyphenyl)-1,2,5-oxadiazol-5-ium-3-yl]phenol |
|---|---|
| PubChem CID | 141465479 |
| Molecular Formula | C17H16N2O6 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 3-[5-oxido-4-(3,4,5-trimethoxyphenyl)-1,2,5-oxadiazol-5-ium-3-yl]phenol |
| SMILES | COc1cc(-c2c(-c3cccc(O)c3)no[n+]2[O-])cc(OC)c1OC |
| InChI | InChI=1S/C17H16N2O6/c1-22-13-8-11(9-14(23-2)17(13)24-3)16-15(18-25-19(16)21)10-5-4-6-12(20)7-10/h4-9,20H,1-3H3 |
| InChIKey | UOSRYPMDTVBTEG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|