C11H24BF4N3O2 — CID 141471658
(4-acetamido-2,2,6,6-tetramethylpiperidin-1-yl)oxyazanium tetrafluoroborate (PubChem CID 141471658) has the molecular formula C11H24BF4N3O2 and a molecular weight of 317.14 g/mol. Its IUPAC name is (4-acetamido-2,2,6,6-tetramethylpiperidin-1-yl)oxyazanium tetrafluoroborate.
| Compound Name | (4-acetamido-2,2,6,6-tetramethylpiperidin-1-yl)oxyazanium tetrafluoroborate |
|---|---|
| PubChem CID | 141471658 |
| Molecular Formula | C11H24BF4N3O2 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | (4-acetamido-2,2,6,6-tetramethylpiperidin-1-yl)oxyazanium tetrafluoroborate |
| SMILES | CC(=O)NC1CC(C)(C)N(O[NH3+])C(C)(C)C1.F[B-](F)(F)F |
| InChI | InChI=1S/C11H23N3O2.BF4/c1-8(15)13-9-6-10(2,3)14(16-12)11(4,5)7-9;2-1(3,4)5/h9H,6-7H2,1-5,12H3;/q;-1/p+1 |
| InChIKey | DDEICDYEJZQWSU-UHFFFAOYSA-O |
| XLogP | 1.53 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|