C26H30O3 — CID 141473572
2-[(2-methyl-6-prop-2-enylphenyl)-[(2-methyl-6-prop-2-enylphenyl)-(oxiran-2-yl)methoxy]methyl]oxirane (PubChem CID 141473572) has the molecular formula C26H30O3 and a molecular weight of 390.52 g/mol. Its IUPAC name is 2-[(2-methyl-6-prop-2-enylphenyl)-[(2-methyl-6-prop-2-enylphenyl)-(oxiran-2-yl)methoxy]methyl]oxirane.
| Compound Name | 2-[(2-methyl-6-prop-2-enylphenyl)-[(2-methyl-6-prop-2-enylphenyl)-(oxiran-2-yl)methoxy]methyl]oxirane |
|---|---|
| PubChem CID | 141473572 |
| Molecular Formula | C26H30O3 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-[(2-methyl-6-prop-2-enylphenyl)-[(2-methyl-6-prop-2-enylphenyl)-(oxiran-2-yl)methoxy]methyl]oxirane |
| SMILES | C=CCc1cccc(C)c1C(OC(c1c(C)cccc1CC=C)C1CO1)C1CO1 |
| InChI | InChI=1S/C26H30O3/c1-5-9-19-13-7-11-17(3)23(19)25(21-15-27-21)29-26(22-16-28-22)24-18(4)12-8-14-20(24)10-6-2/h5-8,11-14,21-22,25-26H,1-2,9-10,15-16H2,3-4H3 |
| InChIKey | FEYWNXLDXUMHQB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|