C30H34O7 — CID 175318150
2-[[2,3-bis(oxiran-2-ylmethyl)phenyl]-[[2,3-bis(oxiran-2-ylmethyl)phenyl]-(oxiran-2-yl)methoxy]methyl]oxirane (PubChem CID 175318150) has the molecular formula C30H34O7 and a molecular weight of 506.60 g/mol. Its IUPAC name is 2-[[2,3-bis(oxiran-2-ylmethyl)phenyl]-[[2,3-bis(oxiran-2-ylmethyl)phenyl]-(oxiran-2-yl)methoxy]methyl]oxirane.
| Compound Name | 2-[[2,3-bis(oxiran-2-ylmethyl)phenyl]-[[2,3-bis(oxiran-2-ylmethyl)phenyl]-(oxiran-2-yl)methoxy]methyl]oxirane |
|---|---|
| PubChem CID | 175318150 |
| Molecular Formula | C30H34O7 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 2-[[2,3-bis(oxiran-2-ylmethyl)phenyl]-[[2,3-bis(oxiran-2-ylmethyl)phenyl]-(oxiran-2-yl)methoxy]methyl]oxirane |
| SMILES | c1cc(CC2CO2)c(CC2CO2)c(C(OC(c2cccc(CC3CO3)c2CC2CO2)C2CO2)C2CO2)c1 |
| InChI | InChI=1S/C30H34O7/c1-3-17(7-19-11-31-19)25(9-21-13-33-21)23(5-1)29(27-15-35-27)37-30(28-16-36-28)24-6-2-4-18(8-20-12-32-20)26(24)10-22-14-34-22/h1-6,19-22,27-30H,7-16H2 |
| InChIKey | XQVCVYJLKXVNKJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|