C15H19NO4 — CID 118275272
N-[2,3-bis(oxiran-2-ylmethyl)phenyl]-N-(oxiran-2-ylmethyl)hydroxylamine (PubChem CID 118275272) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-[2,3-bis(oxiran-2-ylmethyl)phenyl]-N-(oxiran-2-ylmethyl)hydroxylamine.
| Compound Name | N-[2,3-bis(oxiran-2-ylmethyl)phenyl]-N-(oxiran-2-ylmethyl)hydroxylamine |
|---|---|
| PubChem CID | 118275272 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-[2,3-bis(oxiran-2-ylmethyl)phenyl]-N-(oxiran-2-ylmethyl)hydroxylamine |
| SMILES | ON(CC1CO1)c1cccc(CC2CO2)c1CC1CO1 |
| InChI | InChI=1S/C15H19NO4/c17-16(6-13-9-20-13)15-3-1-2-10(4-11-7-18-11)14(15)5-12-8-19-12/h1-3,11-13,17H,4-9H2 |
| InChIKey | INBHHFZSTUVPRB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|