C18H24N2O6S — CID 155884597
N,2,3,4-tetrakis(oxiran-2-ylmethyl)benzenesulfonohydrazide (PubChem CID 155884597) has the molecular formula C18H24N2O6S and a molecular weight of 396.47 g/mol. Its IUPAC name is N,2,3,4-tetrakis(oxiran-2-ylmethyl)benzenesulfonohydrazide.
| Compound Name | N,2,3,4-tetrakis(oxiran-2-ylmethyl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 155884597 |
| Molecular Formula | C18H24N2O6S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N,2,3,4-tetrakis(oxiran-2-ylmethyl)benzenesulfonohydrazide |
| SMILES | NN(CC1CO1)S(=O)(=O)c1ccc(CC2CO2)c(CC2CO2)c1CC1CO1 |
| InChI | InChI=1S/C18H24N2O6S/c19-20(6-15-10-26-15)27(21,22)18-2-1-11(3-12-7-23-12)16(4-13-8-24-13)17(18)5-14-9-25-14/h1-2,12-15H,3-10,19H2 |
| InChIKey | JMPOYPHVZJKTET-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|