C5H4Cl2F3NO2S — CID 141474365
2,2-dichloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile (PubChem CID 141474365) has the molecular formula C5H4Cl2F3NO2S and a molecular weight of 270.06 g/mol. Its IUPAC name is 2,2-dichloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile.
| Compound Name | 2,2-dichloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile |
|---|---|
| PubChem CID | 141474365 |
| Molecular Formula | C5H4Cl2F3NO2S |
| Molecular Weight | 270.06 g/mol |
| Exact Mass | 268.93 |
| IUPAC Name | 2,2-dichloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile |
| SMILES | N#CC(Cl)(Cl)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C5H4Cl2F3NO2S/c6-4(7,3-11)14(12,13)2-1-5(8,9)10/h1-2H2 |
| InChIKey | QEZOKPXMJMRSBV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.06 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|