C13H14 — CID 141475755
6-methyl-1,2,3,5-tetrahydro-as-indacene (PubChem CID 141475755) has the molecular formula C13H14 and a molecular weight of 170.25 g/mol. Its IUPAC name is 6-methyl-1,2,3,5-tetrahydro-as-indacene.
| Compound Name | 6-methyl-1,2,3,5-tetrahydro-as-indacene |
|---|---|
| PubChem CID | 141475755 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 6-methyl-1,2,3,5-tetrahydro-as-indacene |
| SMILES | CC1=C2CC=C3CCCC3=C2C=C1 |
| InChI | InChI=1S/C13H14/c1-9-5-7-13-11(9)8-6-10-3-2-4-12(10)13/h5-7H,2-4,8H2,1H3 |
| InChIKey | NERFIKBKUFZHII-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |