C26H31NO3 — CID 141477633
benzyl (2S)-2-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-benzyl-4-oxobutanoate (PubChem CID 141477633) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is benzyl (2S)-2-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-benzyl-4-oxobutanoate.
| Compound Name | benzyl (2S)-2-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-benzyl-4-oxobutanoate |
|---|---|
| PubChem CID | 141477633 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | benzyl (2S)-2-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-benzyl-4-oxobutanoate |
| SMILES | O=CC[C@@](Cc1ccccc1)(C(=O)OCc1ccccc1)N1C[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C26H31NO3/c28-16-15-26(17-21-9-3-1-4-10-21,25(29)30-20-22-11-5-2-6-12-22)27-18-23-13-7-8-14-24(23)19-27/h1-6,9-12,16,23-24H,7-8,13-15,17-20H2/t23-,24+,26-/m1/s1 |
| InChIKey | YEXHUDSRCOBOKM-RMTZWNOUSA-N |
| XLogP | 4.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|