C14H17NO4 — CID 57115981
benzyl 2-hydroxy-3-oxo-2-pyrrolidin-1-ylpropanoate (PubChem CID 57115981) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is benzyl 2-hydroxy-3-oxo-2-pyrrolidin-1-ylpropanoate.
| Compound Name | benzyl 2-hydroxy-3-oxo-2-pyrrolidin-1-ylpropanoate |
|---|---|
| PubChem CID | 57115981 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | benzyl 2-hydroxy-3-oxo-2-pyrrolidin-1-ylpropanoate |
| SMILES | O=CC(O)(C(=O)OCc1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C14H17NO4/c16-11-14(18,15-8-4-5-9-15)13(17)19-10-12-6-2-1-3-7-12/h1-3,6-7,11,18H,4-5,8-10H2 |
| InChIKey | APPHHCBXQKDKQA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|