C18H19N7 — CID 141477846
2-[(3R)-3-(4-amino-3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl]acetonitrile (PubChem CID 141477846) has the molecular formula C18H19N7 and a molecular weight of 333.40 g/mol. Its IUPAC name is 2-[(3R)-3-(4-amino-3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl]acetonitrile.
| Compound Name | 2-[(3R)-3-(4-amino-3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 141477846 |
| Molecular Formula | C18H19N7 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[(3R)-3-(4-amino-3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl]acetonitrile |
| SMILES | N#CCN1CCC[C@@H](n2nc(-c3ccccc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C18H19N7/c19-8-10-24-9-4-7-14(11-24)25-18-15(17(20)21-12-22-18)16(23-25)13-5-2-1-3-6-13/h1-3,5-6,12,14H,4,7,9-11H2,(H2,20,21,22)/t14-/m1/s1 |
| InChIKey | WWJHPGVYBOHJHC-CQSZACIVSA-N |
| XLogP | 2.24 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|