C15H9F13O — CID 141482579
2-ethenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxymethylidene)cyclohexa-1,3-diene (PubChem CID 141482579) has the molecular formula C15H9F13O and a molecular weight of 452.21 g/mol. Its IUPAC name is 2-ethenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxymethylidene)cyclohexa-1,3-diene.
| Compound Name | 2-ethenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxymethylidene)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141482579 |
| Molecular Formula | C15H9F13O |
| Molecular Weight | 452.21 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 2-ethenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxymethylidene)cyclohexa-1,3-diene |
| SMILES | C=CC1=CCC(=COC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C=C1 |
| InChI | InChI=1S/C15H9F13O/c1-2-8-3-5-9(6-4-8)7-29-15(27,28)13(22,23)11(18,19)10(16,17)12(20,21)14(24,25)26/h2-5,7H,1,6H2 |
| InChIKey | GQSHUVZUWPOAHG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.21 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|