C16H23NO8 — CID 141490851
[4-[(2R,3R,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-methyloxan-2-yl]oxyphenyl]methyl N-ethylcarbamate (PubChem CID 141490851) has the molecular formula C16H23NO8 and a molecular weight of 357.36 g/mol. Its IUPAC name is [4-[(2R,3R,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-methyloxan-2-yl]oxyphenyl]methyl N-ethylcarbamate.
| Compound Name | [4-[(2R,3R,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-methyloxan-2-yl]oxyphenyl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 141490851 |
| Molecular Formula | C16H23NO8 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [4-[(2R,3R,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-methyloxan-2-yl]oxyphenyl]methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCc1ccc(O[C@]2(O)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C16H23NO8/c1-3-17-15(21)23-8-10-4-6-11(7-5-10)25-16(22)14(20)13(19)12(18)9(2)24-16/h4-7,9,12-14,18-20,22H,3,8H2,1-2H3,(H,17,21)/t9-,12-,13+,14+,16+/m0/s1 |
| InChIKey | AAGLDBHWTYIQHK-ZOSCBJAVSA-N |
| XLogP | -0.54 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|