C27H36N2O12S — CID 178182279
1,3-bis[[4-[(2R,3R,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-methyloxan-2-yl]oxyphenyl]methyl]thiourea (PubChem CID 178182279) has the molecular formula C27H36N2O12S and a molecular weight of 612.65 g/mol. Its IUPAC name is 1,3-bis[[4-[(2R,3R,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-methyloxan-2-yl]oxyphenyl]methyl]thiourea.
| Compound Name | 1,3-bis[[4-[(2R,3R,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-methyloxan-2-yl]oxyphenyl]methyl]thiourea |
|---|---|
| PubChem CID | 178182279 |
| Molecular Formula | C27H36N2O12S |
| Molecular Weight | 612.65 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | 1,3-bis[[4-[(2R,3R,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-methyloxan-2-yl]oxyphenyl]methyl]thiourea |
| SMILES | C[C@@H]1O[C@@](O)(Oc2ccc(CNC(=S)NCc3ccc(O[C@]4(O)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)cc3)cc2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H36N2O12S/c1-13-19(30)21(32)23(34)26(36,38-13)40-17-7-3-15(4-8-17)11-28-25(42)29-12-16-5-9-18(10-6-16)41-27(37)24(35)22(33)20(31)14(2)39-27/h3-10,13-14,19-24,30-37H,11-12H2,1-2H3,(H2,28,29,42)/t13-,14-,19-,20-,21+,22+,23+,24+,26+,27+/m0/s1 |
| InChIKey | CAIDLSWSNBFQJZ-YVBKQLCBSA-N |
| XLogP | -2.10 |
| TPSA | 222.82 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.65 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|