C24H31NO7 — CID 11102328
benzyl N-[2-[4-[(2S,3R,4R,5R,6S)-4-hydroxy-3,5-dimethoxy-6-methyloxan-2-yl]oxyphenyl]ethyl]carbamate (PubChem CID 11102328) has the molecular formula C24H31NO7 and a molecular weight of 445.51 g/mol. Its IUPAC name is benzyl N-[2-[4-[(2S,3R,4R,5R,6S)-4-hydroxy-3,5-dimethoxy-6-methyloxan-2-yl]oxyphenyl]ethyl]carbamate.
| Compound Name | benzyl N-[2-[4-[(2S,3R,4R,5R,6S)-4-hydroxy-3,5-dimethoxy-6-methyloxan-2-yl]oxyphenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 11102328 |
| Molecular Formula | C24H31NO7 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | benzyl N-[2-[4-[(2S,3R,4R,5R,6S)-4-hydroxy-3,5-dimethoxy-6-methyloxan-2-yl]oxyphenyl]ethyl]carbamate |
| SMILES | CO[C@@H]1[C@@H](O)[C@@H](OC)[C@H](Oc2ccc(CCNC(=O)OCc3ccccc3)cc2)O[C@H]1C |
| InChI | InChI=1S/C24H31NO7/c1-16-21(28-2)20(26)22(29-3)23(31-16)32-19-11-9-17(10-12-19)13-14-25-24(27)30-15-18-7-5-4-6-8-18/h4-12,16,20-23,26H,13-15H2,1-3H3,(H,25,27)/t16-,20+,21-,22+,23-/m0/s1 |
| InChIKey | CEGXNEWRQUMVCZ-YMNDLRCVSA-N |
| XLogP | 2.67 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |